About 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-1H-pyrazin-2-one
3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-1H-pyrazin-2-one (PubChem CID 103744350) has the molecular formula C8H9N5O2
and a molecular weight of 207.19 g/mol. Its IUPAC name is 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-1H-pyrazin-2-one.
Molecular Properties
| Compound Name | 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-1H-pyrazin-2-one |
| PubChem CID | 103744350 |
| Molecular Formula | C8H9N5O2 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-1H-pyrazin-2-one |
| SMILES | O=c1[nH]ccnc1NCCc1ncno1 |
| InChI | InChI=1S/C8H9N5O2/c14-8-7(10-3-4-11-8)9-2-1-6-12-5-13-15-6/h3-5H,1-2H2,(H,9,10)(H,11,14) |
| InChIKey | QCPLTURDVNLVHH-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-1H-pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-1H-pyrazin-2-one?
The IUPAC name of 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-1H-pyrazin-2-one (CID 103744350) is 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-1H-pyrazin-2-one.
What is the SMILES notation for 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-1H-pyrazin-2-one?
The canonical SMILES for 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-1H-pyrazin-2-one is O=c1[nH]ccnc1NCCc1ncno1.
What is the InChIKey of 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-1H-pyrazin-2-one?
The InChIKey is QCPLTURDVNLVHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5O2/c14-8-7(10-3-4-11-8)9-2-1-6-12-5-13-15-6/h3-5H,1-2H2,(H,9,10)(H,11,14).
What are the key properties of 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-1H-pyrazin-2-one?
3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-1H-pyrazin-2-one has a molecular weight of 207.19 g/mol, XLogP of -0.19, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-1H-pyrazin-2-one is sourced from PubChem (CID 103744350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).