C9H12N6O3 — CID 103744378
2,4-dimethyl-6-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-1,2,4-triazine-3,5-dione (PubChem CID 103744378) has the molecular formula C9H12N6O3 and a molecular weight of 252.23 g/mol. Its IUPAC name is 2,4-dimethyl-6-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-1,2,4-triazine-3,5-dione.
| Compound Name | 2,4-dimethyl-6-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 103744378 |
| Molecular Formula | C9H12N6O3 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2,4-dimethyl-6-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-1,2,4-triazine-3,5-dione |
| SMILES | Cn1nc(NCCc2ncno2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C9H12N6O3/c1-14-8(16)7(13-15(2)9(14)17)10-4-3-6-11-5-12-18-6/h5H,3-4H2,1-2H3,(H,10,13) |
| InChIKey | RDFHDNUYGJHWDX-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 107.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |