About (3S,4R)-4-methylthiolan-3-ol
(3S,4R)-4-methylthiolan-3-ol (PubChem CID 10374449) has the molecular formula C5H10OS
and a molecular weight of 118.20 g/mol. Its IUPAC name is (3S,4R)-4-methylthiolan-3-ol.
Molecular Properties
| Compound Name | (3S,4R)-4-methylthiolan-3-ol |
| PubChem CID | 10374449 |
| Molecular Formula | C5H10OS |
| Molecular Weight | 118.20 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | (3S,4R)-4-methylthiolan-3-ol |
| SMILES | C[C@H]1CSC[C@H]1O |
| InChI | InChI=1S/C5H10OS/c1-4-2-7-3-5(4)6/h4-6H,2-3H2,1H3/t4-,5+/m0/s1 |
| InChIKey | FJKFLHDRFQNJLY-CRCLSJGQSA-N |
| XLogP | 0.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,4R)-4-methylthiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-4-methylthiolan-3-ol?
The IUPAC name of (3S,4R)-4-methylthiolan-3-ol (CID 10374449) is (3S,4R)-4-methylthiolan-3-ol.
What is the SMILES notation for (3S,4R)-4-methylthiolan-3-ol?
The canonical SMILES for (3S,4R)-4-methylthiolan-3-ol is C[C@H]1CSC[C@H]1O.
What is the InChIKey of (3S,4R)-4-methylthiolan-3-ol?
The InChIKey is FJKFLHDRFQNJLY-CRCLSJGQSA-N. The full InChI is InChI=1S/C5H10OS/c1-4-2-7-3-5(4)6/h4-6H,2-3H2,1H3/t4-,5+/m0/s1.
What are the key properties of (3S,4R)-4-methylthiolan-3-ol?
(3S,4R)-4-methylthiolan-3-ol has a molecular weight of 118.20 g/mol, XLogP of 0.73, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-4-methylthiolan-3-ol is sourced from PubChem (CID 10374449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).