C9H10BrN3OS — CID 103744724
N-[(5-bromothiophen-2-yl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine (PubChem CID 103744724) has the molecular formula C9H10BrN3OS and a molecular weight of 288.17 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 103744724 |
| Molecular Formula | C9H10BrN3OS |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine |
| SMILES | Brc1ccc(CNCCc2ncno2)s1 |
| InChI | InChI=1S/C9H10BrN3OS/c10-8-2-1-7(15-8)5-11-4-3-9-12-6-13-14-9/h1-2,6,11H,3-5H2 |
| InChIKey | XSSANBLGRZFHCB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|