About 3-aminobutylphosphonous acid
3-aminobutylphosphonous acid (PubChem CID 10374515) has the molecular formula C4H12NO2P
and a molecular weight of 137.12 g/mol. Its IUPAC name is 3-aminobutylphosphonous acid.
Molecular Properties
| Compound Name | 3-aminobutylphosphonous acid |
| PubChem CID | 10374515 |
| Molecular Formula | C4H12NO2P |
| Molecular Weight | 137.12 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | 3-aminobutylphosphonous acid |
| SMILES | CC(N)CCP(O)O |
| InChI | InChI=1S/C4H12NO2P/c1-4(5)2-3-8(6)7/h4,6-7H,2-3,5H2,1H3 |
| InChIKey | YGWJJSDTMOQPOF-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.12 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-aminobutylphosphonous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminobutylphosphonous acid?
The IUPAC name of 3-aminobutylphosphonous acid (CID 10374515) is 3-aminobutylphosphonous acid.
What is the SMILES notation for 3-aminobutylphosphonous acid?
The canonical SMILES for 3-aminobutylphosphonous acid is CC(N)CCP(O)O.
What is the InChIKey of 3-aminobutylphosphonous acid?
The InChIKey is YGWJJSDTMOQPOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12NO2P/c1-4(5)2-3-8(6)7/h4,6-7H,2-3,5H2,1H3.
What are the key properties of 3-aminobutylphosphonous acid?
3-aminobutylphosphonous acid has a molecular weight of 137.12 g/mol, XLogP of 0.02, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminobutylphosphonous acid is sourced from PubChem (CID 10374515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).