C14H11ClN4O — CID 103745233
N-(6-chloro-5-methyl-3-pyridinyl)pyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 103745233) has the molecular formula C14H11ClN4O and a molecular weight of 286.72 g/mol. Its IUPAC name is N-(6-chloro-5-methyl-3-pyridinyl)pyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-(6-chloro-5-methyl-3-pyridinyl)pyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103745233 |
| Molecular Formula | C14H11ClN4O |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | N-(6-chloro-5-methyl-3-pyridinyl)pyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cnn3ccccc23)cnc1Cl |
| InChI | InChI=1S/C14H11ClN4O/c1-9-6-10(7-16-13(9)15)18-14(20)11-8-17-19-5-3-2-4-12(11)19/h2-8H,1H3,(H,18,20) |
| InChIKey | ZYMNEBPACRZUGC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|