C9H14O — CID 10374540
(2S)-2-(1,1-dideuterioprop-2-enyl)cyclohexan-1-one (PubChem CID 10374540) has the molecular formula C9H14O and a molecular weight of 140.22 g/mol. Its IUPAC name is (2S)-2-(1,1-dideuterioprop-2-enyl)cyclohexan-1-one.
| Compound Name | (2S)-2-(1,1-dideuterioprop-2-enyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 10374540 |
| Molecular Formula | C9H14O |
| Molecular Weight | 140.22 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (2S)-2-(1,1-dideuterioprop-2-enyl)cyclohexan-1-one |
| SMILES | [2H]C([2H])(C=C)[C@@H]1CCCCC1=O |
| InChI | InChI=1S/C9H14O/c1-2-5-8-6-3-4-7-9(8)10/h2,8H,1,3-7H2/t8-/m1/s1/i5D2 |
| InChIKey | UPGHEUSRLZSXAE-JZAVKUPRSA-N |
| XLogP | 2.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|