C8H11F4NOS2 — CID 103747301
N-(1,4-dithian-2-ylmethyl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 103747301) has the molecular formula C8H11F4NOS2 and a molecular weight of 277.31 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103747301 |
| Molecular Formula | C8H11F4NOS2 |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | O=C(NCC1CSCCS1)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H11F4NOS2/c9-6(10)8(11,12)7(14)13-3-5-4-15-1-2-16-5/h5-6H,1-4H2,(H,13,14) |
| InChIKey | XCZUQDDEZSCIBC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|