About [(3S)-3,4-dihydroisoquinolin-3-yl]methanol
[(3S)-3,4-dihydroisoquinolin-3-yl]methanol (PubChem CID 10374731) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is [(3S)-3,4-dihydroisoquinolin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S)-3,4-dihydroisoquinolin-3-yl]methanol |
| PubChem CID | 10374731 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | [(3S)-3,4-dihydroisoquinolin-3-yl]methanol |
| SMILES | OC[C@@H]1Cc2ccccc2C=N1 |
| InChI | InChI=1S/C10H11NO/c12-7-10-5-8-3-1-2-4-9(8)6-11-10/h1-4,6,10,12H,5,7H2/t10-/m0/s1 |
| InChIKey | AFOVIOXUPITRSC-JTQLQIEISA-N |
| XLogP | 1.02 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3S)-3,4-dihydroisoquinolin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-3,4-dihydroisoquinolin-3-yl]methanol?
The IUPAC name of [(3S)-3,4-dihydroisoquinolin-3-yl]methanol (CID 10374731) is [(3S)-3,4-dihydroisoquinolin-3-yl]methanol.
What is the SMILES notation for [(3S)-3,4-dihydroisoquinolin-3-yl]methanol?
The canonical SMILES for [(3S)-3,4-dihydroisoquinolin-3-yl]methanol is OC[C@@H]1Cc2ccccc2C=N1.
What is the InChIKey of [(3S)-3,4-dihydroisoquinolin-3-yl]methanol?
The InChIKey is AFOVIOXUPITRSC-JTQLQIEISA-N. The full InChI is InChI=1S/C10H11NO/c12-7-10-5-8-3-1-2-4-9(8)6-11-10/h1-4,6,10,12H,5,7H2/t10-/m0/s1.
What are the key properties of [(3S)-3,4-dihydroisoquinolin-3-yl]methanol?
[(3S)-3,4-dihydroisoquinolin-3-yl]methanol has a molecular weight of 161.20 g/mol, XLogP of 1.02, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-3,4-dihydroisoquinolin-3-yl]methanol is sourced from PubChem (CID 10374731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).