About 3-benzyloxolane
3-benzyloxolane (PubChem CID 10374748) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is 3-benzyloxolane.
Molecular Properties
| Compound Name | 3-benzyloxolane |
| PubChem CID | 10374748 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 3-benzyloxolane |
| SMILES | c1ccc(CC2CCOC2)cc1 |
| InChI | InChI=1S/C11H14O/c1-2-4-10(5-3-1)8-11-6-7-12-9-11/h1-5,11H,6-9H2 |
| InChIKey | PMXWKVSABVAGCT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-benzyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyloxolane?
The IUPAC name of 3-benzyloxolane (CID 10374748) is 3-benzyloxolane.
What is the SMILES notation for 3-benzyloxolane?
The canonical SMILES for 3-benzyloxolane is c1ccc(CC2CCOC2)cc1.
What is the InChIKey of 3-benzyloxolane?
The InChIKey is PMXWKVSABVAGCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O/c1-2-4-10(5-3-1)8-11-6-7-12-9-11/h1-5,11H,6-9H2.
What are the key properties of 3-benzyloxolane?
3-benzyloxolane has a molecular weight of 162.23 g/mol, XLogP of 2.27, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyloxolane is sourced from PubChem (CID 10374748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).