About 4-methoxy-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)butanamide
4-methoxy-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)butanamide (PubChem CID 103747790) has the molecular formula C9H16F3NO3
and a molecular weight of 243.22 g/mol. Its IUPAC name is 4-methoxy-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)butanamide.
Molecular Properties
| Compound Name | 4-methoxy-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)butanamide |
| PubChem CID | 103747790 |
| Molecular Formula | C9H16F3NO3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 4-methoxy-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)butanamide |
| SMILES | COCC(C)CC(=O)NCC(O)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO3/c1-6(5-16-2)3-8(15)13-4-7(14)9(10,11)12/h6-7,14H,3-5H2,1-2H3,(H,13,15) |
| InChIKey | PNKVLWBDTNBMQO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)butanamide?
The IUPAC name of 4-methoxy-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)butanamide (CID 103747790) is 4-methoxy-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)butanamide.
What is the SMILES notation for 4-methoxy-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)butanamide?
The canonical SMILES for 4-methoxy-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)butanamide is COCC(C)CC(=O)NCC(O)C(F)(F)F.
What is the InChIKey of 4-methoxy-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)butanamide?
The InChIKey is PNKVLWBDTNBMQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO3/c1-6(5-16-2)3-8(15)13-4-7(14)9(10,11)12/h6-7,14H,3-5H2,1-2H3,(H,13,15).
What are the key properties of 4-methoxy-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)butanamide?
4-methoxy-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)butanamide has a molecular weight of 243.22 g/mol, XLogP of 0.70, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-3-methyl-N-(3,3,3-trifluoro-2-hydroxypropyl)butanamide is sourced from PubChem (CID 103747790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).