C11H20O — CID 10374826
(3S,4R,5E)-3,4,7-trimethylocta-1,5-dien-4-ol (PubChem CID 10374826) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (3S,4R,5E)-3,4,7-trimethylocta-1,5-dien-4-ol.
| Compound Name | (3S,4R,5E)-3,4,7-trimethylocta-1,5-dien-4-ol |
|---|---|
| PubChem CID | 10374826 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (3S,4R,5E)-3,4,7-trimethylocta-1,5-dien-4-ol |
| SMILES | C=C[C@H](C)[C@](C)(O)/C=C/C(C)C |
| InChI | InChI=1S/C11H20O/c1-6-10(4)11(5,12)8-7-9(2)3/h6-10,12H,1H2,2-5H3/b8-7+/t10-,11+/m0/s1 |
| InChIKey | CKZYZDUBIWAONY-IAYMVZNDSA-N |
| XLogP | 2.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|