C13H16BrFN2O3S — CID 103748835
4-(4-bromo-3-fluorophenyl)sulfonyl-1,3,3-trimethylpiperazin-2-one (PubChem CID 103748835) has the molecular formula C13H16BrFN2O3S and a molecular weight of 379.25 g/mol. Its IUPAC name is 4-(4-bromo-3-fluorophenyl)sulfonyl-1,3,3-trimethylpiperazin-2-one.
| Compound Name | 4-(4-bromo-3-fluorophenyl)sulfonyl-1,3,3-trimethylpiperazin-2-one |
|---|---|
| PubChem CID | 103748835 |
| Molecular Formula | C13H16BrFN2O3S |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | 4-(4-bromo-3-fluorophenyl)sulfonyl-1,3,3-trimethylpiperazin-2-one |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(Br)c(F)c2)C(C)(C)C1=O |
| InChI | InChI=1S/C13H16BrFN2O3S/c1-13(2)12(18)16(3)6-7-17(13)21(19,20)9-4-5-10(14)11(15)8-9/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | DSMQHQLDUYLTKE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |