C12H15N — CID 10374901
1,2,6,7,8,8a-hexahydroacenaphthylen-1-amine (PubChem CID 10374901) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 1,2,6,7,8,8a-hexahydroacenaphthylen-1-amine.
| Compound Name | 1,2,6,7,8,8a-hexahydroacenaphthylen-1-amine |
|---|---|
| PubChem CID | 10374901 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 1,2,6,7,8,8a-hexahydroacenaphthylen-1-amine |
| SMILES | NC1Cc2cccc3c2C1CCC3 |
| InChI | InChI=1S/C12H15N/c13-11-7-9-5-1-3-8-4-2-6-10(11)12(8)9/h1,3,5,10-11H,2,4,6-7,13H2 |
| InChIKey | BYSMHQKTZDAZEW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |