C12H16F4N2O — CID 103749883
3-ethyl-1-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]pentan-2-ol (PubChem CID 103749883) has the molecular formula C12H16F4N2O and a molecular weight of 280.27 g/mol. Its IUPAC name is 3-ethyl-1-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]pentan-2-ol.
| Compound Name | 3-ethyl-1-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 103749883 |
| Molecular Formula | C12H16F4N2O |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 3-ethyl-1-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]pentan-2-ol |
| SMILES | CCC(CC)C(O)CNc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C12H16F4N2O/c1-3-6(4-2)7(19)5-17-10-8(13)11(15)18-12(16)9(10)14/h6-7,19H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | KLNOWFBSHBUZQF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|