C11H10F4N2 — CID 103749935
2,3,5,6-tetrafluoro-N-hex-5-yn-3-ylpyridin-4-amine (PubChem CID 103749935) has the molecular formula C11H10F4N2 and a molecular weight of 246.21 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-hex-5-yn-3-ylpyridin-4-amine.
| Compound Name | 2,3,5,6-tetrafluoro-N-hex-5-yn-3-ylpyridin-4-amine |
|---|---|
| PubChem CID | 103749935 |
| Molecular Formula | C11H10F4N2 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-hex-5-yn-3-ylpyridin-4-amine |
| SMILES | C#CCC(CC)Nc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C11H10F4N2/c1-3-5-6(4-2)16-9-7(12)10(14)17-11(15)8(9)13/h1,6H,4-5H2,2H3,(H,16,17) |
| InChIKey | JSSBLIXTSUNLOO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|