C8H3F4N3S — CID 103749944
2,3,5,6-tetrafluoro-4-(1H-imidazol-2-ylsulfanyl)pyridine (PubChem CID 103749944) has the molecular formula C8H3F4N3S and a molecular weight of 249.19 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(1H-imidazol-2-ylsulfanyl)pyridine.
| Compound Name | 2,3,5,6-tetrafluoro-4-(1H-imidazol-2-ylsulfanyl)pyridine |
|---|---|
| PubChem CID | 103749944 |
| Molecular Formula | C8H3F4N3S |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(1H-imidazol-2-ylsulfanyl)pyridine |
| SMILES | Fc1nc(F)c(F)c(Sc2ncc[nH]2)c1F |
| InChI | InChI=1S/C8H3F4N3S/c9-3-5(16-8-13-1-2-14-8)4(10)7(12)15-6(3)11/h1-2H,(H,13,14) |
| InChIKey | IXYGEDDRVPNWCJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|