C13H16INOS — CID 103750051
2-iodo-3-methyl-N-(thiolan-2-ylmethyl)benzamide (PubChem CID 103750051) has the molecular formula C13H16INOS and a molecular weight of 361.25 g/mol. Its IUPAC name is 2-iodo-3-methyl-N-(thiolan-2-ylmethyl)benzamide.
| Compound Name | 2-iodo-3-methyl-N-(thiolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 103750051 |
| Molecular Formula | C13H16INOS |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | 2-iodo-3-methyl-N-(thiolan-2-ylmethyl)benzamide |
| SMILES | Cc1cccc(C(=O)NCC2CCCS2)c1I |
| InChI | InChI=1S/C13H16INOS/c1-9-4-2-6-11(12(9)14)13(16)15-8-10-5-3-7-17-10/h2,4,6,10H,3,5,7-8H2,1H3,(H,15,16) |
| InChIKey | YCTFUWHYLRLRLF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|