About 4,5-dimethyl-2-thiophen-2-yl-1,3-oxazole
4,5-dimethyl-2-thiophen-2-yl-1,3-oxazole (PubChem CID 10375014) has the molecular formula C9H9NOS
and a molecular weight of 179.24 g/mol. Its IUPAC name is 4,5-dimethyl-2-thiophen-2-yl-1,3-oxazole.
Molecular Properties
| Compound Name | 4,5-dimethyl-2-thiophen-2-yl-1,3-oxazole |
| PubChem CID | 10375014 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 4,5-dimethyl-2-thiophen-2-yl-1,3-oxazole |
| SMILES | Cc1nc(-c2cccs2)oc1C |
| InChI | InChI=1S/C9H9NOS/c1-6-7(2)11-9(10-6)8-4-3-5-12-8/h3-5H,1-2H3 |
| InChIKey | VPIJKQZYMHVKEY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dimethyl-2-thiophen-2-yl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2-thiophen-2-yl-1,3-oxazole?
The IUPAC name of 4,5-dimethyl-2-thiophen-2-yl-1,3-oxazole (CID 10375014) is 4,5-dimethyl-2-thiophen-2-yl-1,3-oxazole.
What is the SMILES notation for 4,5-dimethyl-2-thiophen-2-yl-1,3-oxazole?
The canonical SMILES for 4,5-dimethyl-2-thiophen-2-yl-1,3-oxazole is Cc1nc(-c2cccs2)oc1C.
What is the InChIKey of 4,5-dimethyl-2-thiophen-2-yl-1,3-oxazole?
The InChIKey is VPIJKQZYMHVKEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NOS/c1-6-7(2)11-9(10-6)8-4-3-5-12-8/h3-5H,1-2H3.
What are the key properties of 4,5-dimethyl-2-thiophen-2-yl-1,3-oxazole?
4,5-dimethyl-2-thiophen-2-yl-1,3-oxazole has a molecular weight of 179.24 g/mol, XLogP of 3.02, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2-thiophen-2-yl-1,3-oxazole is sourced from PubChem (CID 10375014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).