C9H7BrF3NOS — CID 103750205
5-bromo-N-[1-(trifluoromethyl)cyclopropyl]thiophene-3-carboxamide (PubChem CID 103750205) has the molecular formula C9H7BrF3NOS and a molecular weight of 314.13 g/mol. Its IUPAC name is 5-bromo-N-[1-(trifluoromethyl)cyclopropyl]thiophene-3-carboxamide.
| Compound Name | 5-bromo-N-[1-(trifluoromethyl)cyclopropyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 103750205 |
| Molecular Formula | C9H7BrF3NOS |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 312.94 |
| IUPAC Name | 5-bromo-N-[1-(trifluoromethyl)cyclopropyl]thiophene-3-carboxamide |
| SMILES | O=C(NC1(C(F)(F)F)CC1)c1csc(Br)c1 |
| InChI | InChI=1S/C9H7BrF3NOS/c10-6-3-5(4-16-6)7(15)14-8(1-2-8)9(11,12)13/h3-4H,1-2H2,(H,14,15) |
| InChIKey | LRTMVXOVBDPAEK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |