About 2-(methylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile
2-(methylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile (PubChem CID 10375184) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-(methylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile.
Molecular Properties
| Compound Name | 2-(methylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile |
| PubChem CID | 10375184 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-(methylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile |
| SMILES | CNC1(C#N)CCc2ccccc2C1 |
| InChI | InChI=1S/C12H14N2/c1-14-12(9-13)7-6-10-4-2-3-5-11(10)8-12/h2-5,14H,6-8H2,1H3 |
| InChIKey | VYLKXRWZNWSMJI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(methylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile?
The IUPAC name of 2-(methylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile (CID 10375184) is 2-(methylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile.
What is the SMILES notation for 2-(methylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile?
The canonical SMILES for 2-(methylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile is CNC1(C#N)CCc2ccccc2C1.
What is the InChIKey of 2-(methylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile?
The InChIKey is VYLKXRWZNWSMJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-14-12(9-13)7-6-10-4-2-3-5-11(10)8-12/h2-5,14H,6-8H2,1H3.
What are the key properties of 2-(methylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile?
2-(methylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile has a molecular weight of 186.26 g/mol, XLogP of 1.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)-3,4-dihydro-1H-naphthalene-2-carbonitrile is sourced from PubChem (CID 10375184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).