C15H21BrN2O — CID 103752661
(2-bromo-3-pyridinyl)-(4-propylazepan-1-yl)methanone (PubChem CID 103752661) has the molecular formula C15H21BrN2O and a molecular weight of 325.25 g/mol. Its IUPAC name is (2-bromo-3-pyridinyl)-(4-propylazepan-1-yl)methanone.
| Compound Name | (2-bromo-3-pyridinyl)-(4-propylazepan-1-yl)methanone |
|---|---|
| PubChem CID | 103752661 |
| Molecular Formula | C15H21BrN2O |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | (2-bromo-3-pyridinyl)-(4-propylazepan-1-yl)methanone |
| SMILES | CCCC1CCCN(C(=O)c2cccnc2Br)CC1 |
| InChI | InChI=1S/C15H21BrN2O/c1-2-5-12-6-4-10-18(11-8-12)15(19)13-7-3-9-17-14(13)16/h3,7,9,12H,2,4-6,8,10-11H2,1H3 |
| InChIKey | CJQMJFGQJJDPJC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|