About 2-methyl-3-phenyl-1,2,4-thiadiazol-5-imine
2-methyl-3-phenyl-1,2,4-thiadiazol-5-imine (PubChem CID 10375297) has the molecular formula C9H9N3S
and a molecular weight of 191.26 g/mol. Its IUPAC name is 2-methyl-3-phenyl-1,2,4-thiadiazol-5-imine.
Molecular Properties
| Compound Name | 2-methyl-3-phenyl-1,2,4-thiadiazol-5-imine |
| PubChem CID | 10375297 |
| Molecular Formula | C9H9N3S |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 2-methyl-3-phenyl-1,2,4-thiadiazol-5-imine |
| SMILES | [H]/N=c1/nc(-c2ccccc2)n(C)s1 |
| InChI | InChI=1S/C9H9N3S/c1-12-8(11-9(10)13-12)7-5-3-2-4-6-7/h2-6,10H,1H3/b10-9- |
| InChIKey | ITQJGQKMXZLCCI-KTKRTIGZSA-N |
| XLogP | 1.63 |
| TPSA | 41.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-phenyl-1,2,4-thiadiazol-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-phenyl-1,2,4-thiadiazol-5-imine?
The IUPAC name of 2-methyl-3-phenyl-1,2,4-thiadiazol-5-imine (CID 10375297) is 2-methyl-3-phenyl-1,2,4-thiadiazol-5-imine.
What is the SMILES notation for 2-methyl-3-phenyl-1,2,4-thiadiazol-5-imine?
The canonical SMILES for 2-methyl-3-phenyl-1,2,4-thiadiazol-5-imine is [H]/N=c1/nc(-c2ccccc2)n(C)s1.
What is the InChIKey of 2-methyl-3-phenyl-1,2,4-thiadiazol-5-imine?
The InChIKey is ITQJGQKMXZLCCI-KTKRTIGZSA-N. The full InChI is InChI=1S/C9H9N3S/c1-12-8(11-9(10)13-12)7-5-3-2-4-6-7/h2-6,10H,1H3/b10-9-.
What are the key properties of 2-methyl-3-phenyl-1,2,4-thiadiazol-5-imine?
2-methyl-3-phenyl-1,2,4-thiadiazol-5-imine has a molecular weight of 191.26 g/mol, XLogP of 1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-phenyl-1,2,4-thiadiazol-5-imine is sourced from PubChem (CID 10375297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).