C12H19NO — CID 10375351
2,7,7-trimethyltricyclo[4.1.1.02,4]octane-3-carboxamide (PubChem CID 10375351) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 2,7,7-trimethyltricyclo[4.1.1.02,4]octane-3-carboxamide.
| Compound Name | 2,7,7-trimethyltricyclo[4.1.1.02,4]octane-3-carboxamide |
|---|---|
| PubChem CID | 10375351 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2,7,7-trimethyltricyclo[4.1.1.02,4]octane-3-carboxamide |
| SMILES | CC1(C)C2CC3C(C(N)=O)C3(C)C1C2 |
| InChI | InChI=1S/C12H19NO/c1-11(2)6-4-7-9(10(13)14)12(7,3)8(11)5-6/h6-9H,4-5H2,1-3H3,(H2,13,14) |
| InChIKey | NHLYOIUCJSYQOS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |