C14H20BrN3O — CID 103754766
2-bromo-N-(2-piperidin-1-ylpropyl)pyridine-4-carboxamide (PubChem CID 103754766) has the molecular formula C14H20BrN3O and a molecular weight of 326.24 g/mol. Its IUPAC name is 2-bromo-N-(2-piperidin-1-ylpropyl)pyridine-4-carboxamide.
| Compound Name | 2-bromo-N-(2-piperidin-1-ylpropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 103754766 |
| Molecular Formula | C14H20BrN3O |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 2-bromo-N-(2-piperidin-1-ylpropyl)pyridine-4-carboxamide |
| SMILES | CC(CNC(=O)c1ccnc(Br)c1)N1CCCCC1 |
| InChI | InChI=1S/C14H20BrN3O/c1-11(18-7-3-2-4-8-18)10-17-14(19)12-5-6-16-13(15)9-12/h5-6,9,11H,2-4,7-8,10H2,1H3,(H,17,19) |
| InChIKey | ZFAAQOCMHRVFBN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|