C11H16N2OS — CID 103755604
1-cyano-3-methyl-N-(thiolan-3-yl)cyclobutane-1-carboxamide (PubChem CID 103755604) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 1-cyano-3-methyl-N-(thiolan-3-yl)cyclobutane-1-carboxamide.
| Compound Name | 1-cyano-3-methyl-N-(thiolan-3-yl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 103755604 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-cyano-3-methyl-N-(thiolan-3-yl)cyclobutane-1-carboxamide |
| SMILES | CC1CC(C#N)(C(=O)NC2CCSC2)C1 |
| InChI | InChI=1S/C11H16N2OS/c1-8-4-11(5-8,7-12)10(14)13-9-2-3-15-6-9/h8-9H,2-6H2,1H3,(H,13,14) |
| InChIKey | KFFOGQLWNKFILS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |