About 2-(triazol-1-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide
2-(triazol-1-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide (PubChem CID 103755769) has the molecular formula C7H9F3N4O2
and a molecular weight of 238.17 g/mol. Its IUPAC name is 2-(triazol-1-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide.
Molecular Properties
| Compound Name | 2-(triazol-1-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide |
| PubChem CID | 103755769 |
| Molecular Formula | C7H9F3N4O2 |
| Molecular Weight | 238.17 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 2-(triazol-1-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide |
| SMILES | O=C(Cn1ccnn1)NCC(O)C(F)(F)F |
| InChI | InChI=1S/C7H9F3N4O2/c8-7(9,10)5(15)3-11-6(16)4-14-2-1-12-13-14/h1-2,5,15H,3-4H2,(H,11,16) |
| InChIKey | NTRYJXUTXWNNCS-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.17 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(triazol-1-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(triazol-1-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide?
The IUPAC name of 2-(triazol-1-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide (CID 103755769) is 2-(triazol-1-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide.
What is the SMILES notation for 2-(triazol-1-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide?
The canonical SMILES for 2-(triazol-1-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide is O=C(Cn1ccnn1)NCC(O)C(F)(F)F.
What is the InChIKey of 2-(triazol-1-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide?
The InChIKey is NTRYJXUTXWNNCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3N4O2/c8-7(9,10)5(15)3-11-6(16)4-14-2-1-12-13-14/h1-2,5,15H,3-4H2,(H,11,16).
What are the key properties of 2-(triazol-1-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide?
2-(triazol-1-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide has a molecular weight of 238.17 g/mol, XLogP of -0.68, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(triazol-1-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide is sourced from PubChem (CID 103755769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).