C9H12F3NO2 — CID 103755773
N-(3,3,3-trifluoro-2-hydroxypropyl)hexa-2,4-dienamide (PubChem CID 103755773) has the molecular formula C9H12F3NO2 and a molecular weight of 223.19 g/mol. Its IUPAC name is N-(3,3,3-trifluoro-2-hydroxypropyl)hexa-2,4-dienamide.
| Compound Name | N-(3,3,3-trifluoro-2-hydroxypropyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 103755773 |
| Molecular Formula | C9H12F3NO2 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | N-(3,3,3-trifluoro-2-hydroxypropyl)hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)NCC(O)C(F)(F)F |
| InChI | InChI=1S/C9H12F3NO2/c1-2-3-4-5-8(15)13-6-7(14)9(10,11)12/h2-5,7,14H,6H2,1H3,(H,13,15) |
| InChIKey | GEWGLSQGNKPXSI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|