C11H15F3N2O2S2 — CID 103755796
3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide (PubChem CID 103755796) has the molecular formula C11H15F3N2O2S2 and a molecular weight of 328.38 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide.
| Compound Name | 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide |
|---|---|
| PubChem CID | 103755796 |
| Molecular Formula | C11H15F3N2O2S2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide |
| SMILES | Cc1nc(CSCCC(=O)NCC(O)C(F)(F)F)cs1 |
| InChI | InChI=1S/C11H15F3N2O2S2/c1-7-16-8(6-20-7)5-19-3-2-10(18)15-4-9(17)11(12,13)14/h6,9,17H,2-5H2,1H3,(H,15,18) |
| InChIKey | VBATUELVEYOUIK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|