C11H10F3N5O2 — CID 103755862
4-(2H-tetrazol-5-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide (PubChem CID 103755862) has the molecular formula C11H10F3N5O2 and a molecular weight of 301.23 g/mol. Its IUPAC name is 4-(2H-tetrazol-5-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide.
| Compound Name | 4-(2H-tetrazol-5-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide |
|---|---|
| PubChem CID | 103755862 |
| Molecular Formula | C11H10F3N5O2 |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 4-(2H-tetrazol-5-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)benzamide |
| SMILES | O=C(NCC(O)C(F)(F)F)c1ccc(-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C11H10F3N5O2/c12-11(13,14)8(20)5-15-10(21)7-3-1-6(2-4-7)9-16-18-19-17-9/h1-4,8,20H,5H2,(H,15,21)(H,16,17,18,19) |
| InChIKey | AHYMJOFNMIPDTF-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |