C11H12BrFN2O2 — CID 103755867
N-(2-bromo-5-fluorophenyl)morpholine-4-carboxamide (PubChem CID 103755867) has the molecular formula C11H12BrFN2O2 and a molecular weight of 303.13 g/mol. Its IUPAC name is N-(2-bromo-5-fluorophenyl)morpholine-4-carboxamide.
| Compound Name | N-(2-bromo-5-fluorophenyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 103755867 |
| Molecular Formula | C11H12BrFN2O2 |
| Molecular Weight | 303.13 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | N-(2-bromo-5-fluorophenyl)morpholine-4-carboxamide |
| SMILES | O=C(Nc1cc(F)ccc1Br)N1CCOCC1 |
| InChI | InChI=1S/C11H12BrFN2O2/c12-9-2-1-8(13)7-10(9)14-11(16)15-3-5-17-6-4-15/h1-2,7H,3-6H2,(H,14,16) |
| InChIKey | DBZFLTMYBUKPHX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.13 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |