C10H12F3N3O2 — CID 103755869
(E)-3-(2-methylpyrazol-3-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)prop-2-enamide (PubChem CID 103755869) has the molecular formula C10H12F3N3O2 and a molecular weight of 263.22 g/mol. Its IUPAC name is (E)-3-(2-methylpyrazol-3-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)prop-2-enamide.
| Compound Name | (E)-3-(2-methylpyrazol-3-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)prop-2-enamide |
|---|---|
| PubChem CID | 103755869 |
| Molecular Formula | C10H12F3N3O2 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | (E)-3-(2-methylpyrazol-3-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)prop-2-enamide |
| SMILES | Cn1nccc1/C=C/C(=O)NCC(O)C(F)(F)F |
| InChI | InChI=1S/C10H12F3N3O2/c1-16-7(4-5-15-16)2-3-9(18)14-6-8(17)10(11,12)13/h2-5,8,17H,6H2,1H3,(H,14,18)/b3-2+ |
| InChIKey | JJBJFQVOFVWHSH-NSCUHMNNSA-N |
| XLogP | 0.47 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|