About 3-[(2-chloro-4-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol
3-[(2-chloro-4-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol (PubChem CID 103756566) has the molecular formula C8H8ClF3N2O
and a molecular weight of 240.61 g/mol. Its IUPAC name is 3-[(2-chloro-4-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol.
Molecular Properties
| Compound Name | 3-[(2-chloro-4-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol |
| PubChem CID | 103756566 |
| Molecular Formula | C8H8ClF3N2O |
| Molecular Weight | 240.61 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 3-[(2-chloro-4-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol |
| SMILES | OC(CNc1ccnc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C8H8ClF3N2O/c9-7-3-5(1-2-13-7)14-4-6(15)8(10,11)12/h1-3,6,15H,4H2,(H,13,14) |
| InChIKey | ZTUACOBRUNVELH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.61 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-chloro-4-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-chloro-4-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol?
The IUPAC name of 3-[(2-chloro-4-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol (CID 103756566) is 3-[(2-chloro-4-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol.
What is the SMILES notation for 3-[(2-chloro-4-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol?
The canonical SMILES for 3-[(2-chloro-4-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol is OC(CNc1ccnc(Cl)c1)C(F)(F)F.
What is the InChIKey of 3-[(2-chloro-4-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol?
The InChIKey is ZTUACOBRUNVELH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClF3N2O/c9-7-3-5(1-2-13-7)14-4-6(15)8(10,11)12/h1-3,6,15H,4H2,(H,13,14).
What are the key properties of 3-[(2-chloro-4-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol?
3-[(2-chloro-4-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol has a molecular weight of 240.61 g/mol, XLogP of 2.07, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-chloro-4-pyridinyl)amino]-1,1,1-trifluoropropan-2-ol is sourced from PubChem (CID 103756566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).