C13H19NO — CID 10375676
6-(propylamino)-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 10375676) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 6-(propylamino)-5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | 6-(propylamino)-5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 10375676 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 6-(propylamino)-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | CCCNC1CCc2c(O)cccc2C1 |
| InChI | InChI=1S/C13H19NO/c1-2-8-14-11-6-7-12-10(9-11)4-3-5-13(12)15/h3-5,11,14-15H,2,6-9H2,1H3 |
| InChIKey | VCYPZWCFSAHTQT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |