C6H7NOS3 — CID 10375680
(8aS)-3-sulfanylidene-1,5,6,8a-tetrahydro-[1,3]thiazolo[4,3-c][1,4]thiazin-8-one (PubChem CID 10375680) has the molecular formula C6H7NOS3 and a molecular weight of 205.33 g/mol. Its IUPAC name is (8aS)-3-sulfanylidene-1,5,6,8a-tetrahydro-[1,3]thiazolo[4,3-c][1,4]thiazin-8-one.
| Compound Name | (8aS)-3-sulfanylidene-1,5,6,8a-tetrahydro-[1,3]thiazolo[4,3-c][1,4]thiazin-8-one |
|---|---|
| PubChem CID | 10375680 |
| Molecular Formula | C6H7NOS3 |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 204.97 |
| IUPAC Name | (8aS)-3-sulfanylidene-1,5,6,8a-tetrahydro-[1,3]thiazolo[4,3-c][1,4]thiazin-8-one |
| SMILES | O=C1SCCN2C(=S)SC[C@@H]12 |
| InChI | InChI=1S/C6H7NOS3/c8-5-4-3-11-6(9)7(4)1-2-10-5/h4H,1-3H2/t4-/m0/s1 |
| InChIKey | HVJDTSWLNXXZTG-BYPYZUCNSA-N |
| XLogP | 0.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|