C11H15BrN2O2S — CID 103757043
4-(5-bromo-3-methyl-2-pyridinyl)-1,4-thiazepane 1,1-dioxide (PubChem CID 103757043) has the molecular formula C11H15BrN2O2S and a molecular weight of 319.22 g/mol. Its IUPAC name is 4-(5-bromo-3-methyl-2-pyridinyl)-1,4-thiazepane 1,1-dioxide.
| Compound Name | 4-(5-bromo-3-methyl-2-pyridinyl)-1,4-thiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 103757043 |
| Molecular Formula | C11H15BrN2O2S |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 4-(5-bromo-3-methyl-2-pyridinyl)-1,4-thiazepane 1,1-dioxide |
| SMILES | Cc1cc(Br)cnc1N1CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H15BrN2O2S/c1-9-7-10(12)8-13-11(9)14-3-2-5-17(15,16)6-4-14/h7-8H,2-6H2,1H3 |
| InChIKey | SZASZVCUDVGKSF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |