C14H16BrNO — CID 103757951
2-(3-bromophenyl)-N-hex-5-ynylacetamide (PubChem CID 103757951) has the molecular formula C14H16BrNO and a molecular weight of 294.19 g/mol. Its IUPAC name is 2-(3-bromophenyl)-N-hex-5-ynylacetamide.
| Compound Name | 2-(3-bromophenyl)-N-hex-5-ynylacetamide |
|---|---|
| PubChem CID | 103757951 |
| Molecular Formula | C14H16BrNO |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2-(3-bromophenyl)-N-hex-5-ynylacetamide |
| SMILES | C#CCCCCNC(=O)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C14H16BrNO/c1-2-3-4-5-9-16-14(17)11-12-7-6-8-13(15)10-12/h1,6-8,10H,3-5,9,11H2,(H,16,17) |
| InChIKey | OEPVYGJYUITIRK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|