C11H11Cl2N3O — CID 103758627
5,6-dichloro-N-(cyanomethyl)-N-propan-2-ylpyridine-3-carboxamide (PubChem CID 103758627) has the molecular formula C11H11Cl2N3O and a molecular weight of 272.14 g/mol. Its IUPAC name is 5,6-dichloro-N-(cyanomethyl)-N-propan-2-ylpyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-(cyanomethyl)-N-propan-2-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 103758627 |
| Molecular Formula | C11H11Cl2N3O |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 5,6-dichloro-N-(cyanomethyl)-N-propan-2-ylpyridine-3-carboxamide |
| SMILES | CC(C)N(CC#N)C(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2N3O/c1-7(2)16(4-3-14)11(17)8-5-9(12)10(13)15-6-8/h5-7H,4H2,1-2H3 |
| InChIKey | URFIKDUYCLKQCF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|