C16H14FNO — CID 103758788
5-[(2,5-dimethylphenoxy)methyl]-2-fluorobenzonitrile (PubChem CID 103758788) has the molecular formula C16H14FNO and a molecular weight of 255.29 g/mol. Its IUPAC name is 5-[(2,5-dimethylphenoxy)methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[(2,5-dimethylphenoxy)methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 103758788 |
| Molecular Formula | C16H14FNO |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 5-[(2,5-dimethylphenoxy)methyl]-2-fluorobenzonitrile |
| SMILES | Cc1ccc(C)c(OCc2ccc(F)c(C#N)c2)c1 |
| InChI | InChI=1S/C16H14FNO/c1-11-3-4-12(2)16(7-11)19-10-13-5-6-15(17)14(8-13)9-18/h3-8H,10H2,1-2H3 |
| InChIKey | FQHLFUKAMYPZOH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |