About N-ethyl-1-(4-ethylcyclohexyl)-2,2-difluoroethanamine
N-ethyl-1-(4-ethylcyclohexyl)-2,2-difluoroethanamine (PubChem CID 103759876) has the molecular formula C12H23F2N
and a molecular weight of 219.32 g/mol. Its IUPAC name is N-ethyl-1-(4-ethylcyclohexyl)-2,2-difluoroethanamine.
Molecular Properties
| Compound Name | N-ethyl-1-(4-ethylcyclohexyl)-2,2-difluoroethanamine |
| PubChem CID | 103759876 |
| Molecular Formula | C12H23F2N |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | N-ethyl-1-(4-ethylcyclohexyl)-2,2-difluoroethanamine |
| SMILES | CCNC(C(F)F)C1CCC(CC)CC1 |
| InChI | InChI=1S/C12H23F2N/c1-3-9-5-7-10(8-6-9)11(12(13)14)15-4-2/h9-12,15H,3-8H2,1-2H3 |
| InChIKey | JZTNJZSBPITDBJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-1-(4-ethylcyclohexyl)-2,2-difluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1-(4-ethylcyclohexyl)-2,2-difluoroethanamine?
The IUPAC name of N-ethyl-1-(4-ethylcyclohexyl)-2,2-difluoroethanamine (CID 103759876) is N-ethyl-1-(4-ethylcyclohexyl)-2,2-difluoroethanamine.
What is the SMILES notation for N-ethyl-1-(4-ethylcyclohexyl)-2,2-difluoroethanamine?
The canonical SMILES for N-ethyl-1-(4-ethylcyclohexyl)-2,2-difluoroethanamine is CCNC(C(F)F)C1CCC(CC)CC1.
What is the InChIKey of N-ethyl-1-(4-ethylcyclohexyl)-2,2-difluoroethanamine?
The InChIKey is JZTNJZSBPITDBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23F2N/c1-3-9-5-7-10(8-6-9)11(12(13)14)15-4-2/h9-12,15H,3-8H2,1-2H3.
What are the key properties of N-ethyl-1-(4-ethylcyclohexyl)-2,2-difluoroethanamine?
N-ethyl-1-(4-ethylcyclohexyl)-2,2-difluoroethanamine has a molecular weight of 219.32 g/mol, XLogP of 3.45, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1-(4-ethylcyclohexyl)-2,2-difluoroethanamine is sourced from PubChem (CID 103759876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).