C12H23F2N — CID 103759876
N-ethyl-1-(4-ethylcyclohexyl)-2,2-difluoroethanamine (PubChem CID 103759876) has the molecular formula C12H23F2N and a molecular weight of 219.32 g/mol. Its IUPAC name is N-ethyl-1-(4-ethylcyclohexyl)-2,2-difluoroethanamine.
| Compound Name | N-ethyl-1-(4-ethylcyclohexyl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 103759876 |
| Molecular Formula | C12H23F2N |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | N-ethyl-1-(4-ethylcyclohexyl)-2,2-difluoroethanamine |
| SMILES | CCNC(C(F)F)C1CCC(CC)CC1 |
| InChI | InChI=1S/C12H23F2N/c1-3-9-5-7-10(8-6-9)11(12(13)14)15-4-2/h9-12,15H,3-8H2,1-2H3 |
| InChIKey | JZTNJZSBPITDBJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |