C9H8F3NO2 — CID 10376114
(NE)-N-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]hydroxylamine (PubChem CID 10376114) has the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. Its IUPAC name is (NE)-N-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 10376114 |
| Molecular Formula | C9H8F3NO2 |
| Molecular Weight | 219.16 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | (NE)-N-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]hydroxylamine |
| SMILES | COc1ccc(/C(=N\O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H8F3NO2/c1-15-7-4-2-6(3-5-7)8(13-14)9(10,11)12/h2-5,14H,1H3/b13-8+ |
| InChIKey | GTIRHANHGLHLIQ-MDWZMJQESA-N |
| XLogP | 2.44 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.16 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|