C10H11F3O2 — CID 10376158
(3Z)-3-(2,2,2-trifluoroethylidene)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one (PubChem CID 10376158) has the molecular formula C10H11F3O2 and a molecular weight of 220.19 g/mol. Its IUPAC name is (3Z)-3-(2,2,2-trifluoroethylidene)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one.
| Compound Name | (3Z)-3-(2,2,2-trifluoroethylidene)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one |
|---|---|
| PubChem CID | 10376158 |
| Molecular Formula | C10H11F3O2 |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | (3Z)-3-(2,2,2-trifluoroethylidene)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one |
| SMILES | O=C1OC2CCCCC2/C1=C/C(F)(F)F |
| InChI | InChI=1S/C10H11F3O2/c11-10(12,13)5-7-6-3-1-2-4-8(6)15-9(7)14/h5-6,8H,1-4H2/b7-5- |
| InChIKey | MBULKRNFHXDMCA-ALCCZGGFSA-N |
| XLogP | 2.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|