About 1-[(1-propylcyclopropyl)methyl]-3-(2,2,2-trifluoroethyl)urea
1-[(1-propylcyclopropyl)methyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 103761632) has the molecular formula C10H17F3N2O
and a molecular weight of 238.25 g/mol. Its IUPAC name is 1-[(1-propylcyclopropyl)methyl]-3-(2,2,2-trifluoroethyl)urea.
Molecular Properties
| Compound Name | 1-[(1-propylcyclopropyl)methyl]-3-(2,2,2-trifluoroethyl)urea |
| PubChem CID | 103761632 |
| Molecular Formula | C10H17F3N2O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 1-[(1-propylcyclopropyl)methyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CCCC1(CNC(=O)NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H17F3N2O/c1-2-3-9(4-5-9)6-14-8(16)15-7-10(11,12)13/h2-7H2,1H3,(H2,14,15,16) |
| InChIKey | AMGCUCZDBOZJTR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(1-propylcyclopropyl)methyl]-3-(2,2,2-trifluoroethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1-propylcyclopropyl)methyl]-3-(2,2,2-trifluoroethyl)urea?
The IUPAC name of 1-[(1-propylcyclopropyl)methyl]-3-(2,2,2-trifluoroethyl)urea (CID 103761632) is 1-[(1-propylcyclopropyl)methyl]-3-(2,2,2-trifluoroethyl)urea.
What is the SMILES notation for 1-[(1-propylcyclopropyl)methyl]-3-(2,2,2-trifluoroethyl)urea?
The canonical SMILES for 1-[(1-propylcyclopropyl)methyl]-3-(2,2,2-trifluoroethyl)urea is CCCC1(CNC(=O)NCC(F)(F)F)CC1.
What is the InChIKey of 1-[(1-propylcyclopropyl)methyl]-3-(2,2,2-trifluoroethyl)urea?
The InChIKey is AMGCUCZDBOZJTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3N2O/c1-2-3-9(4-5-9)6-14-8(16)15-7-10(11,12)13/h2-7H2,1H3,(H2,14,15,16).
What are the key properties of 1-[(1-propylcyclopropyl)methyl]-3-(2,2,2-trifluoroethyl)urea?
1-[(1-propylcyclopropyl)methyl]-3-(2,2,2-trifluoroethyl)urea has a molecular weight of 238.25 g/mol, XLogP of 2.43, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1-propylcyclopropyl)methyl]-3-(2,2,2-trifluoroethyl)urea is sourced from PubChem (CID 103761632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).