C11H16N4O — CID 10376175
(10S)-4,6-dimethyl-1,4,5,8-tetrazatricyclo[8.3.0.03,7]trideca-3(7),5-dien-2-one (PubChem CID 10376175) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is (10S)-4,6-dimethyl-1,4,5,8-tetrazatricyclo[8.3.0.03,7]trideca-3(7),5-dien-2-one.
| Compound Name | (10S)-4,6-dimethyl-1,4,5,8-tetrazatricyclo[8.3.0.03,7]trideca-3(7),5-dien-2-one |
|---|---|
| PubChem CID | 10376175 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (10S)-4,6-dimethyl-1,4,5,8-tetrazatricyclo[8.3.0.03,7]trideca-3(7),5-dien-2-one |
| SMILES | Cc1nn(C)c2c1NC[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C11H16N4O/c1-7-9-10(14(2)13-7)11(16)15-5-3-4-8(15)6-12-9/h8,12H,3-6H2,1-2H3/t8-/m0/s1 |
| InChIKey | NXFVLROQFWEKOA-QMMMGPOBSA-N |
| XLogP | 0.76 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |