About [(3Z)-3-butylhepta-3,6-dien-1-ynyl]-trimethylsilane
[(3Z)-3-butylhepta-3,6-dien-1-ynyl]-trimethylsilane (PubChem CID 10376191) has the molecular formula C14H24Si
and a molecular weight of 220.43 g/mol. Its IUPAC name is [(3Z)-3-butylhepta-3,6-dien-1-ynyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(3Z)-3-butylhepta-3,6-dien-1-ynyl]-trimethylsilane |
| PubChem CID | 10376191 |
| Molecular Formula | C14H24Si |
| Molecular Weight | 220.43 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | [(3Z)-3-butylhepta-3,6-dien-1-ynyl]-trimethylsilane |
| SMILES | C=CC/C=C(\C#C[Si](C)(C)C)CCCC |
| InChI | InChI=1S/C14H24Si/c1-6-8-10-14(11-9-7-2)12-13-15(3,4)5/h6,10H,1,7-9,11H2,2-5H3/b14-10- |
| InChIKey | RCJDGRJKWJUOTG-UVTDQMKNSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3Z)-3-butylhepta-3,6-dien-1-ynyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z)-3-butylhepta-3,6-dien-1-ynyl]-trimethylsilane?
The IUPAC name of [(3Z)-3-butylhepta-3,6-dien-1-ynyl]-trimethylsilane (CID 10376191) is [(3Z)-3-butylhepta-3,6-dien-1-ynyl]-trimethylsilane.
What is the SMILES notation for [(3Z)-3-butylhepta-3,6-dien-1-ynyl]-trimethylsilane?
The canonical SMILES for [(3Z)-3-butylhepta-3,6-dien-1-ynyl]-trimethylsilane is C=CC/C=C(\C#C[Si](C)(C)C)CCCC.
What is the InChIKey of [(3Z)-3-butylhepta-3,6-dien-1-ynyl]-trimethylsilane?
The InChIKey is RCJDGRJKWJUOTG-UVTDQMKNSA-N. The full InChI is InChI=1S/C14H24Si/c1-6-8-10-14(11-9-7-2)12-13-15(3,4)5/h6,10H,1,7-9,11H2,2-5H3/b14-10-.
What are the key properties of [(3Z)-3-butylhepta-3,6-dien-1-ynyl]-trimethylsilane?
[(3Z)-3-butylhepta-3,6-dien-1-ynyl]-trimethylsilane has a molecular weight of 220.43 g/mol, XLogP of 4.56, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z)-3-butylhepta-3,6-dien-1-ynyl]-trimethylsilane is sourced from PubChem (CID 10376191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).