C11H21NO2 — CID 103762292
2-ethoxy-N-[(1-propylcyclopropyl)methyl]acetamide (PubChem CID 103762292) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 2-ethoxy-N-[(1-propylcyclopropyl)methyl]acetamide.
| Compound Name | 2-ethoxy-N-[(1-propylcyclopropyl)methyl]acetamide |
|---|---|
| PubChem CID | 103762292 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 2-ethoxy-N-[(1-propylcyclopropyl)methyl]acetamide |
| SMILES | CCCC1(CNC(=O)COCC)CC1 |
| InChI | InChI=1S/C11H21NO2/c1-3-5-11(6-7-11)9-12-10(13)8-14-4-2/h3-9H2,1-2H3,(H,12,13) |
| InChIKey | UNRVUWNQIZTQCZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |