C6H8Cl3FO — CID 10376231
cis-(1S,6S)-2,2,6-trichloro-6-fluorocyclohexan-1-ol (PubChem CID 10376231) has the molecular formula C6H8Cl3FO and a molecular weight of 221.49 g/mol. Its IUPAC name is cis-(1S,6S)-2,2,6-trichloro-6-fluorocyclohexan-1-ol.
| Compound Name | cis-(1S,6S)-2,2,6-trichloro-6-fluorocyclohexan-1-ol |
|---|---|
| PubChem CID | 10376231 |
| Molecular Formula | C6H8Cl3FO |
| Molecular Weight | 221.49 g/mol |
| Exact Mass | 219.96 |
| IUPAC Name | cis-(1S,6S)-2,2,6-trichloro-6-fluorocyclohexan-1-ol |
| SMILES | O[C@@H]1C(Cl)(Cl)CCC[C@]1(F)Cl |
| InChI | InChI=1S/C6H8Cl3FO/c7-5(8)2-1-3-6(9,10)4(5)11/h4,11H,1-3H2/t4-,6-/m1/s1 |
| InChIKey | UPAAPMLQQUDVIH-INEUFUBQSA-N |
| XLogP | 2.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|