C10H12N2O2 — CID 103763001
N-cyclopropyl-N-methyl-2-oxo-1H-pyridine-4-carboxamide (PubChem CID 103763001) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is N-cyclopropyl-N-methyl-2-oxo-1H-pyridine-4-carboxamide.
| Compound Name | N-cyclopropyl-N-methyl-2-oxo-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 103763001 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | N-cyclopropyl-N-methyl-2-oxo-1H-pyridine-4-carboxamide |
| SMILES | CN(C(=O)c1cc[nH]c(=O)c1)C1CC1 |
| InChI | InChI=1S/C10H12N2O2/c1-12(8-2-3-8)10(14)7-4-5-11-9(13)6-7/h4-6,8H,2-3H2,1H3,(H,11,13) |
| InChIKey | SDEPNLMCMVMRMG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |