C14H12ClFN2O2 — CID 103763351
N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-oxo-1H-pyridine-4-carboxamide (PubChem CID 103763351) has the molecular formula C14H12ClFN2O2 and a molecular weight of 294.71 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-oxo-1H-pyridine-4-carboxamide.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-oxo-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 103763351 |
| Molecular Formula | C14H12ClFN2O2 |
| Molecular Weight | 294.71 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-oxo-1H-pyridine-4-carboxamide |
| SMILES | CN(Cc1c(F)cccc1Cl)C(=O)c1cc[nH]c(=O)c1 |
| InChI | InChI=1S/C14H12ClFN2O2/c1-18(8-10-11(15)3-2-4-12(10)16)14(20)9-5-6-17-13(19)7-9/h2-7H,8H2,1H3,(H,17,19) |
| InChIKey | DOESLSXGGGQDIW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.71 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |