C14H13BrClNO2 — CID 103764047
2-bromo-4-chloro-N-[1-(5-methylfuran-2-yl)ethyl]benzamide (PubChem CID 103764047) has the molecular formula C14H13BrClNO2 and a molecular weight of 342.62 g/mol. Its IUPAC name is 2-bromo-4-chloro-N-[1-(5-methylfuran-2-yl)ethyl]benzamide.
| Compound Name | 2-bromo-4-chloro-N-[1-(5-methylfuran-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 103764047 |
| Molecular Formula | C14H13BrClNO2 |
| Molecular Weight | 342.62 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 2-bromo-4-chloro-N-[1-(5-methylfuran-2-yl)ethyl]benzamide |
| SMILES | Cc1ccc(C(C)NC(=O)c2ccc(Cl)cc2Br)o1 |
| InChI | InChI=1S/C14H13BrClNO2/c1-8-3-6-13(19-8)9(2)17-14(18)11-5-4-10(16)7-12(11)15/h3-7,9H,1-2H3,(H,17,18) |
| InChIKey | IAEVHGSNWQVHFG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |